For research use only. Not for therapeutic Use.
2,3-Cyclohexeno pyridine(Cat No.:M063853)is a heterocyclic compound featuring a fused ring structure that combines a pyridine ring with a cyclohexene. This fusion creates a unique scaffold with aromatic and non-aromatic regions, enhancing its chemical reactivity and versatility in organic synthesis. It serves as a valuable intermediate in the synthesis of various pharmaceuticals and agrochemicals, particularly in constructing complex nitrogen-containing compounds. Its dual functionality enables it to participate in a range of chemical reactions, making it a critical component for researchers developing new drugs and materials with specific biological or chemical properties.
CAS Number | 10500-57-9 |
Molecular Formula | C9H11N |
Purity | ≥95% |
IUPAC Name | 5,6,7,8-tetrahydroquinoline |
InChI | InChI=1S/C9H11N/c1-2-6-9-8(4-1)5-3-7-10-9/h3,5,7H,1-2,4,6H2 |
InChIKey | YQDGQEKUTLYWJU-UHFFFAOYSA-N |
SMILES | C1CCC2=C(C1)C=CC=N2 |