For research use only. Not for therapeutic Use.
2,3-Diaminonaphthalene-1,4-dione (Cat.No:L003377) is a pivotal chemical compound with diverse applications in organic synthesis. Its unique structure and reactivity make it a valuable building block for the preparation of various functional materials, highlighting its importance in contemporary chemical research.
| CAS Number | 13755-95-8 |
| Molecular Formula | C10H8N2O2 |
| Purity | ≥95% |
| IUPAC Name | 2,3-diaminonaphthalene-1,4-dione |
| InChI | InChI=1S/C10H8N2O2/c11-7-8(12)10(14)6-4-2-1-3-5(6)9(7)13/h1-4H,11-12H2 |
| InChIKey | YGFBBXYYCLHOOW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C(=C(C2=O)N)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
