For research use only. Not for therapeutic Use.
2,3-Diaminotoluene(CAT: R013689) is a high-purity aromatic diamine compound widely used in pharmaceutical research, polymer chemistry, and material science. Featuring a methyl-substituted benzene ring with two amino groups, it serves as a critical intermediate in the synthesis of dyes, pigments, and bioactive molecules. Its versatile structure enables applications in the development of pharmaceutical intermediates, small-molecule inhibitors, and advanced polymer materials. Known for its chemical reactivity and stability, 2,3-Diaminotoluene supports complex organic transformations, ensuring reliable results in both academic and industrial research. This compound is essential for innovative pathways in fine chemical and pharmaceutical development.
CAS Number | 2687-25-4 |
Synonyms | 3-Methyl-1,2-benzenediamine; Toluene-2,3-diamine; 1,2-Diamino-3-methylbenzene; 1-Methyl-2,3-phenylenediamine; 2,3-Toluylenediamine; 2,3-Tolylenediamine; 2-Amino-3-methylaniline; 3-Methyl-1,2-diaminobenzene; 3-Methyl-1,2-phenylenediamine; 3-Methyl-o-p |
Molecular Formula | C7H10N2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3-methylbenzene-1,2-diamine |
InChI | InChI=1S/C7H10N2/c1-5-3-2-4-6(8)7(5)9/h2-4H,8-9H2,1H3 |
InChIKey | AXNUJYHFQHQZBE-UHFFFAOYSA-N |
SMILES | CC1=C(C(=CC=C1)N)N |