For research use only. Not for therapeutic Use.
2,3-Dibromo-5-methoxypyridine (Cat.No:L003498) is a crucial chemical intermediate used in pharmaceutical research. Its unique structure and reactivity make it a valuable building block for the synthesis of specialized compounds. This compound plays a significant role in the development of pharmaceutical agents, highlighting its importance in modern drug discovery endeavors.
CAS Number | 1211521-89-9 |
Molecular Formula | C6H5Br2NO |
Purity | ≥95% |
IUPAC Name | 2,3-dibromo-5-methoxypyridine |
InChI | InChI=1S/C6H5Br2NO/c1-10-4-2-5(7)6(8)9-3-4/h2-3H,1H3 |
InChIKey | DGGCDSWYPYZWGV-UHFFFAOYSA-N |
SMILES | COC1=CC(=C(N=C1)Br)Br |