2,3-Dichloro-5-(trichloromethyl)pyridine is a chlorinated heterocyclic compound featuring dichloro substituents at the 2 and 3-positions and a trichloromethyl group at the 5-position of a pyridine ring. This compound is significant in organic synthesis and medicinal chemistry due to its potential biological activities, including herbicidal and antifungal properties. The multiple chlorine atoms enhance its reactivity and stability, making it a valuable intermediate for further chemical transformations. Its unique structure allows for applications in the development of agrochemicals and pharmaceuticals.
Catalog Number | L019211 |
CAS Number | 69045-83-6 |
Molecular Formula | C6H2Cl5N |
Purity | ≥95% |
IUPAC Name | 2,3-dichloro-5-(trichloromethyl)pyridine |
InChI | InChI=1S/C6H2Cl5N/c7-4-1-3(6(9,10)11)2-12-5(4)8/h1-2H |
InChIKey | XVBWGQSXLITICX-UHFFFAOYSA-N |
SMILES | C1=C(C=NC(=C1Cl)Cl)C(Cl)(Cl)Cl |