2,3-Dichlorobenzamide is an aromatic compound featuring a benzamide structure with two chlorine atoms positioned at the 2- and 3-positions. This compound is significant in organic synthesis and medicinal chemistry, where it may exhibit biological activities such as antibacterial or antifungal properties. The presence of chlorine substituents enhances its reactivity, making it a valuable intermediate for developing pharmaceuticals and agrochemicals. Its unique structure allows for further modifications, facilitating the exploration of novel therapeutic agents and applications in drug discovery.
Catalog Number | L023047 |
CAS Number | 5980-24-5 |
Molecular Formula | C7H5Cl2NO |
Purity | ≥95% |
IUPAC Name | 2,3-dichlorobenzamide |
InChI | InChI=1S/C7H5Cl2NO/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H,(H2,10,11) |
InChIKey | KZKYRHRAVGWEAV-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1)Cl)Cl)C(=O)N |