For research use only. Not for therapeutic Use.
2,3-Dichloropyridin-4-ol(CAT: L026961) is a high-purity chlorinated pyridinol derivative widely utilized in pharmaceutical and organic synthesis. Featuring two chlorine atoms and a hydroxyl group on a pyridine core, this compound serves as a valuable intermediate for creating bioactive molecules and exploring novel chemical pathways. Its unique structure and reactivity make it particularly useful in medicinal chemistry for designing therapeutic agents and advanced materials. With excellent stability and precise composition, 2,3-Dichloropyridin-4-ol ensures reliable performance, making it a critical tool for researchers in drug discovery, fine chemical production, and innovative chemical synthesis.
| CAS Number | 1174047-06-3 |
| Molecular Formula | C5H3Cl2NO |
| Purity | ≥95% |
| IUPAC Name | 2,3-dichloro-1H-pyridin-4-one |
| InChI | InChI=1S/C5H3Cl2NO/c6-4-3(9)1-2-8-5(4)7/h1-2H,(H,8,9) |
| InChIKey | OIIQOSKJOINELL-UHFFFAOYSA-N |
| SMILES | C1=CNC(=C(C1=O)Cl)Cl |
