For research use only. Not for therapeutic Use.
2,3-Dichloropyrido[3,4-b]pyrazine(Cat No.:L025767)is a halogenated heterocyclic compound widely used in pharmaceutical research and chemical synthesis. Featuring a fused pyridine-pyrazine ring system with chlorine atoms at the 2 and 3 positions, this compound serves as a key intermediate in the development of bioactive molecules, particularly in the synthesis of potential anticancer, antiviral, and antimicrobial agents. Its unique structure and reactivity make it a valuable building block for creating complex chemical architectures. With high purity, 2,3-Dichloropyrido[3,4-b]pyrazine supports cutting-edge research in drug discovery and development.
CAS Number | 35251-99-1 |
Molecular Formula | C7H3Cl2N3 |
Purity | ≥95% |
IUPAC Name | 2,3-dichloropyrido[3,4-b]pyrazine |
InChI | InChI=1S/C7H3Cl2N3/c8-6-7(9)12-5-3-10-2-1-4(5)11-6/h1-3H |
InChIKey | GZTHKSLJDQQAGP-UHFFFAOYSA-N |
SMILES | C1=CN=CC2=C1N=C(C(=N2)Cl)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |