For research use only. Not for therapeutic Use.
2,3-Difluoro-1-methyl-4-nitrobenzene is a fluorinated aromatic compound with methyl and nitro substituents, featuring fluorine atoms at the 2- and 3-positions on a benzene ring. This compound is commonly used as an intermediate in the synthesis of pharmaceuticals and agrochemicals due to its reactivity and electron-withdrawing properties from the nitro and fluorine groups. Its structure allows for selective transformations, aiding in the construction of complex molecules. It supports efficient synthesis routes in advanced chemical research and drug development.
CAS Number | 932373-72-3 |
Molecular Formula | C7H5F2NO2 |
Purity | ≥95% |
IUPAC Name | 2,3-difluoro-1-methyl-4-nitrobenzene |
InChI | InChI=1S/C7H5F2NO2/c1-4-2-3-5(10(11)12)7(9)6(4)8/h2-3H,1H3 |
InChIKey | DQKUCXAFYAIKFJ-UHFFFAOYSA-N |
SMILES | CC1=C(C(=C(C=C1)[N+](=O)[O-])F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |