For research use only. Not for therapeutic Use.
2,3-Difluoro-5-nitrobenzoic acid(CAT: L031982) is an aromatic compound featuring two fluorine atoms at the 2 and 3 positions and a nitro group at the 5 position on a benzoic acid core. This compound is commonly used as an intermediate in organic synthesis, particularly in pharmaceutical and agrochemical research. The presence of both electron-withdrawing nitro and fluoro groups makes it reactive for further chemical transformations, allowing it to participate in reactions such as nucleophilic substitution and coupling reactions. 2,3-Difluoro-5-nitrobenzoic acid is valued for its role in developing bioactive molecules, where it serves as a precursor for synthesizing more complex structures in the study of enzyme inhibition, receptor modulation, and antimicrobial activity.
CAS Number | 942035-31-6 |
Molecular Formula | C7H3F2NO4 |
Purity | ≥95% |
IUPAC Name | 2,3-difluoro-5-nitrobenzoic acid |
InChI | InChI=1S/C7H3F2NO4/c8-5-2-3(10(13)14)1-4(6(5)9)7(11)12/h1-2H,(H,11,12) |
InChIKey | MURQTOITBVYFMS-UHFFFAOYSA-N |