For research use only. Not for therapeutic Use.
2,3-Difluorobenzoic Acid (Cat.No:R042803) is a chemical compound containing two fluorine atoms on a benzene ring. It is used as a building block in the synthesis of various organic compounds. This compound’s unique structure and reactivity make it valuable in pharmaceutical and agrochemical research for the development of new molecules and drugs.
CAS Number | 4519-39-5 |
Molecular Formula | C7H4F2O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2,3-difluorobenzoic acid |
InChI | InChI=1S/C7H4F2O2/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H,(H,10,11) |
InChIKey | JLZVIWSFUPLSOR-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1)F)F)C(=O)O |