For research use only. Not for therapeutic Use.
2,3-Difluorobenzylamine（Cat No.:L011540）is an organic compound featuring a benzylamine core with two fluorine atoms at the 2 and 3 positions on the aromatic ring. This compound is widely used in pharmaceutical and chemical research as a versatile building block for synthesizing bioactive molecules, including potential drug candidates. The presence of fluorine atoms enhances the compound’s chemical stability and biological activity, making it valuable for developing complex organic compounds. 2,3-Difluorobenzylamine is essential for researchers focused on innovative synthetic methodologies and advancing medicinal chemistry.
| Catalog Number | L011540 |
| CAS Number | 72235-51-9 |
| Molecular Formula | C7H7F2N |
| Purity | ≥95% |
| IUPAC Name | (2,3-difluorophenyl)methanamine |
| InChI | InChI=1S/C7H7F2N/c8-6-3-1-2-5(4-10)7(6)9/h1-3H,4,10H2 |
| InChIKey | OHZUCDHZOHSBPZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)F)CN |
