For research use only. Not for therapeutic Use.
2,3-Dihydro-1H-pyrrolo[3,4-C]pyridin-1-one is a heterocyclic compound commonly utilized in pharmaceutical and organic synthesis due to its unique pyrrolopyridine structure. This compound serves as a valuable scaffold in drug discovery, particularly in the development of inhibitors and modulators targeting specific enzymes and receptors. Its fused-ring system adds structural diversity, enabling researchers to create bioactive molecules with enhanced potency and selectivity. Applications extend to medicinal chemistry and advanced material science, where it aids in synthesizing targeted compounds for therapeutic research.
CAS Number | 5655-00-5 |
Molecular Formula | C7H6N2O |
Purity | ≥95% |
IUPAC Name | 2,3-dihydropyrrolo[3,4-c]pyridin-1-one |
InChI | InChI=1S/C7H6N2O/c10-7-6-1-2-8-3-5(6)4-9-7/h1-3H,4H2,(H,9,10) |
InChIKey | QDSJMVZVUSYEMY-UHFFFAOYSA-N |
SMILES | C1C2=C(C=CN=C2)C(=O)N1 |