For research use only. Not for therapeutic Use.
2,3-Dihydro-3-hydroxy-2-oxo Lysergide is a chemical derivative of lysergic acid diethylamide (LSD), a well-known psychedelic compound. This specific derivative involves the reduction and oxidation of certain functional groups on the LSD molecule, potentially altering its psychoactive properties. It is primarily used in research settings to study the pharmacological effects and metabolic pathways of LSD.
CAS Number | 111295-09-1 |
Synonyms | N,N-Diethyl-2,3-dihydro-3-hydroxy-2-oxo-lysergamide; (8β)-9,10-Didehydro-N,N-diethyl-2,3-dihydro-3-hydroxy-6-methyl-2-oxoergoline-8-carboxamide; 2-Oxo-3-hydroxy-LSD; 2-Oxo-3-hydroxy Lysergic Acid Diethylamide; |
Molecular Formula | C20H25N3O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (6aR,9R)-N,N-diethyl-5a-hydroxy-7-methyl-5-oxo-6,6a,8,9-tetrahydro-4H-indolo[4,3-fg]quinoline-9-carboxamide |
InChI | InChI=1S/C20H25N3O3/c1-4-23(5-2)18(24)12-9-14-13-7-6-8-15-17(13)20(26,19(25)21-15)10-16(14)22(3)11-12/h6-9,12,16,26H,4-5,10-11H2,1-3H3,(H,21,25)/t12-,16-,20?/m1/s1 |
InChIKey | YSZSHHCNLVHCNV-VRORWYBRSA-N |
SMILES | CCN(CC)C(=O)C1CN(C2CC3(C4=C(C2=C1)C=CC=C4NC3=O)O)C |