For research use only. Not for therapeutic Use.
2,3-Dihydrobenzo[b]furan-7-methanol is a benzofuran derivative featuring a methanol group attached to the 7th position of the fused ring structure. This compound is commonly used in organic synthesis as a building block for pharmaceuticals and other bioactive molecules. Its fused benzofuran structure provides a versatile framework for further chemical modifications, making it valuable for drug discovery and development. It is often explored in medicinal chemistry for its potential in developing therapeutic agents, particularly in neurological and cardiovascular research.
Catalog Number | M091887 |
CAS Number | 151155-53-2 |
Molecular Formula | C9H10O2 |
Purity | ≥95% |
Storage | Store at RT |
IUPAC Name | 2,3-dihydro-1-benzofuran-7-ylmethanol |
InChI | InChI=1S/C9H10O2/c10-6-8-3-1-2-7-4-5-11-9(7)8/h1-3,10H,4-6H2 |
InChIKey | WUXXIPOWZJYRNE-UHFFFAOYSA-N |
SMILES | C1COC2=C1C=CC=C2CO |