Home
>
Chemical Reagents>Heterocyclic Building Blocks> 2,3-Dihydrothieno[3,4-b][1,4]dioxine-5-carbonitrile
For research use only. Not for therapeutic Use.
2,3-Dihydrothieno[3,4-b][1,4]dioxine-5-carbonitrile(Cat No.:L007695), is a chemical compound featuring a thieno[3,4-b][1,4]dioxine ring system with a carbonitrile group at the 5-position. This specific molecular structure is significant in organic synthesis and medicinal chemistry. Researchers utilize it as a valuable building block in the creation of diverse organic molecules, especially in the development of pharmaceuticals and agrochemicals. Its unique structure allows for various chemical modifications, making it valuable in the design and synthesis of novel compounds for drug discovery, research purposes, and industrial applications, contributing to advancements in chemical research and chemical development.
CAS Number | 859851-02-8 |
Molecular Formula | C7H5NO2S |
Purity | ≥95% |
IUPAC Name | 2,3-dihydrothieno[3,4-b][1,4]dioxine-5-carbonitrile |
InChI | InChI=1S/C7H5NO2S/c8-3-6-7-5(4-11-6)9-1-2-10-7/h4H,1-2H2 |
InChIKey | HSQAPDOVCIFQCU-UHFFFAOYSA-N |
SMILES | C1COC2=C(SC=C2O1)C#N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |