For research use only. Not for therapeutic Use.
2′,3′-Dihydroxyacetophenone (Cat No.:R013226) is a chemical compound with the molecular formula C8H8O3. It is a derivative of acetophenone, featuring hydroxyl groups at positions 2′ and 3′ on the phenyl ring. This compound is significant in organic synthesis and chemical research due to its potential applications in various reactions. 2′,3′-Dihydroxyacetophenone is often used as a building block in the synthesis of various pharmaceuticals and biologically active compounds. The presence of hydroxyl groups enhances its reactivity and versatility in chemical transformations, supporting its use in the creation of valuable molecules in medicinal and pharmaceutical chemistry.
CAS Number | 13494-10-5 |
Synonyms | 1-(2,3-Dihydroxyphenyl)ethanone; 3-Acetyl-1,2-benzenediol; |
Molecular Formula | C8H8O3 |
Purity | ≥95% |
Storage | Room Temperature |
IUPAC Name | 1-(2,3-dihydroxyphenyl)ethanone |
InChI | InChI=1S/C8H8O3/c1-5(9)6-3-2-4-7(10)8(6)11/h2-4,10-11H,1H3 |
InChIKey | HEJLFBLJYFSKCE-UHFFFAOYSA-N |
SMILES | CC(=O)C1=C(C(=CC=C1)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |