For research use only. Not for therapeutic Use.
2,3-Dihydroxypropyl Acrylate (CAT: M123004) is a chemical compound used primarily in the field of polymer chemistry. It is an acrylate monomer that contains both hydroxyl and acrylic functional groups. This compound is commonly used in the synthesis of polymers and copolymers for various applications, such as adhesives, coatings, and resins. The presence of acrylic groups makes it suitable for free radical polymerization processes, allowing it to become part of polymeric materials with diverse properties.
Catalog Number | M123004 |
CAS Number | 10095-20-2 |
Molecular Formula | C6H10O4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2,3-dihydroxypropyl prop-2-enoate |
InChI | InChI=1S/C6H10O4/c1-2-6(9)10-4-5(8)3-7/h2,5,7-8H,1,3-4H2 |
InChIKey | OWPUOLBODXJOKH-UHFFFAOYSA-N |
SMILES | C=CC(=O)OCC(CO)O |