For research use only. Not for therapeutic Use.
2,3-Dimethoxy-5-methyl-6-[all trans]farnesylfarnesyl-1,4-benzoquinone(Cat No.:M070380) is a mouthful, but its chemical structure speaks volumes. This compound, a derivative of benzoquinone, showcases a complex arrangement of atoms. The “2,3-Dimethoxy” indicates two methoxy (CH3O) groups attached at positions 2 and 3, while “5-methyl” signifies a methyl (CH3) group at position 5. Moreover, the compound features a farnesyl farnesyl moiety, suggesting the presence of two farnesyl groups, typical in terpenes. This intricate structure hints at potential biological activities, as compounds with similar motifs often exhibit antioxidant or pharmacological properties.
Catalog Number | M070380 |
CAS Number | 1065-31-2 |
Molecular Formula | C39H58O4 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | -20°C |
IUPAC Name | 2-[(2E,6E,10E,14E,18E)-3,7,11,15,19,23-hexamethyltetracosa-2,6,10,14,18,22-hexaenyl]-5,6-dimethoxy-3-methylcyclohexa-2,5-diene-1,4-dione |
InChI | InChI=1S/C39H58O4/c1-28(2)16-11-17-29(3)18-12-19-30(4)20-13-21-31(5)22-14-23-32(6)24-15-25-33(7)26-27-35-34(8)36(40)38(42-9)39(43-10)37(35)41/h16,18,20,22,24,26H,11-15,17,19,21,23,25,27H2,1-10H3/b29-18+,30-20+,31-22+,32-24+,33-26+ |
InChIKey | GXNFPEOUKFOTKY-LPHQIWJTSA-N |
SMILES | CC1=C(C(=O)C(=C(C1=O)OC)OC)CC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C |