For research use only. Not for therapeutic Use.
2,3-Dimethoxybenzaldehyde（Cat No.:R053824）is an organic compound widely used in organic synthesis, particularly in the preparation of aromatic compounds and as an intermediate in pharmaceutical and chemical research. This aldehyde, featuring methoxy groups at the 2 and 3 positions of the benzene ring, serves as a building block for the synthesis of biologically active molecules. Its versatile reactivity makes it useful in the design of compounds with potential applications in drug development, especially in the synthesis of flavonoids and other bioactive organic compounds.
| Catalog Number | R053824 |
| CAS Number | 86-51-1 |
| Synonyms | o-Veratraldehyde; 5,6-Dimethoxybenzaldehyde; |
| Molecular Formula | C9H10O3 |
| Purity | ≥95% |
| Storage | 3 years -20C powder |
| IUPAC Name | 2,3-dimethoxybenzaldehyde |
| InChI | InChI=1S/C9H10O3/c1-11-8-5-3-4-7(6-10)9(8)12-2/h3-6H,1-2H3 |
| InChIKey | JIVGSHFYXPRRSZ-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1OC)C=O |
