For research use only. Not for therapeutic Use.
2,3-Dimethyl-1H-indole-7-carboxylic acid is an indole derivative characterized by methyl groups at the 2 and 3 positions and a carboxylic acid at the 7 position. This compound exhibits unique chemical properties due to its aromatic indole structure, making it valuable in organic synthesis and medicinal chemistry. The carboxylic acid functionality allows for various chemical transformations, while the dimethyl substitution may enhance lipophilicity and biological activity. This compound can serve as a scaffold for developing pharmaceuticals and exploring structure-activity relationships.
CAS Number | 103986-07-8 |
Synonyms | 2,3-dimethyl-1H-indole-7-carboxylic acid(SALTDATA: FREE) |
Molecular Formula | C11H11NO2 |
Purity | ≥95% |
Storage | Desiccate at -20C |
IUPAC Name | 2,3-dimethyl-1H-indole-7-carboxylic acid |
InChI | InChI=1S/C11H11NO2/c1-6-7(2)12-10-8(6)4-3-5-9(10)11(13)14/h3-5,12H,1-2H3,(H,13,14) |
InChIKey | ITMIUTVFOTYMOJ-UHFFFAOYSA-N |
SMILES | CC1=C(NC2=C1C=CC=C2C(=O)O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |