For research use only. Not for therapeutic Use.
2,3-Dimethyl-5-nitroaniline(Cat No.:L034716)is a chemical compound featuring a nitro group and two methyl groups attached to an aniline ring. It serves as a crucial intermediate in the synthesis of dyes, pigments, and pharmaceuticals. The compound’s unique structure allows it to participate in various organic reactions, making it valuable in producing complex chemical entities. Its role in manufacturing azo dyes, which are used in textile and printing industries, highlights its industrial significance. Additionally, it contributes to the development of advanced materials and specialty chemicals.
CAS Number | 106837-44-9 |
Molecular Formula | C8H10N2O2 |
Purity | ≥95% |
IUPAC Name | 2,3-dimethyl-5-nitroaniline |
InChI | InChI=1S/C8H10N2O2/c1-5-3-7(10(11)12)4-8(9)6(5)2/h3-4H,9H2,1-2H3 |
InChIKey | RSRLXRIHUGVPDS-UHFFFAOYSA-N |
SMILES | CC1=CC(=CC(=C1C)N)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |