For research use only. Not for therapeutic Use.
2,3-Dimethylbutanoic Acid(Cat No.:R031617)is a branched-chain carboxylic acid commonly used in organic synthesis and pharmaceutical research. Its structure, featuring two methyl groups on the butanoic acid backbone, provides unique steric properties, making it a valuable building block in the synthesis of complex molecules. This compound is often employed in the development of active pharmaceutical ingredients (APIs), agrochemicals, and specialty chemicals. Its reactivity and stability make it ideal for various chemical transformations, contributing to the creation of innovative compounds in medicinal chemistry and material science.
CAS Number | 14287-61-7 |
Synonyms | 2,3-Dimethylbutanoic Acid; α,β-Dimethyl-Butyric Acid; ?(±)-2,3-Dimethylbutanoic Acid; (±)-2,3-Dimethylbutyric Acid; 2,3-Dimethylbutanoic Acid; 2,3-Dimethylbutyric Acid |
Molecular Formula | C6H12O2 |
Purity | ≥95% |
IUPAC Name | 2,3-dimethylbutanoic acid |
InChI | InChI=1S/C6H12O2/c1-4(2)5(3)6(7)8/h4-5H,1-3H3,(H,7,8) |
InChIKey | XFOASZQZPWEJAA-UHFFFAOYSA-N |
SMILES | CC(C)C(C)C(=O)O |