For research use only. Not for therapeutic Use.
2,3-Dimethylsuccinic acid (Cat.No:M055083) is a chemical compound with two methyl groups attached to a succinic acid backbone. It finds applications in organic synthesis and biochemical research as a versatile building block. Its unique structure contributes to its potential in the creation of diverse molecules in various scientific and industrial contexts.
Catalog Number | M055083 |
CAS Number | 13545-04-5 |
Molecular Formula | C6H10O4 |
Purity | ≥95% |
Storage | Store at -20C |
IUPAC Name | 2,3-dimethylbutanedioic acid |
InChI | InChI=1S/C6H10O4/c1-3(5(7)8)4(2)6(9)10/h3-4H,1-2H3,(H,7,8)(H,9,10) |
InChIKey | KLZYRCVPDWTZLH-UHFFFAOYSA-N |
SMILES | CC(C(C)C(=O)O)C(=O)O |