For research use only. Not for therapeutic Use.
2,3-Naphthalic anhydride is a chemical compound used primarily in the synthesis of dyes, pigments, and other organic intermediates. It is a derivative of naphthalene where two adjacent carbon atoms in the ring are bonded to an oxygen atom, forming an anhydride. This structure makes it a reactive aromatic anhydride, useful in various chemical reactions to produce compounds with complex aromatic systems. Its applications extend to the pharmaceutical industry, where it serves as a precursor in several drug synthesis processes.
CAS Number | 716-39-2 |
Synonyms | Naphtho[2,3-c]furan-1,3-dione; ?2,3-Naphthalenedicarboxylic Anhydride; 1,3-ββ-Isonaphthofurandione; 2,3-Naphthalenedicarboxylic Acid Anhydride |
Molecular Formula | C12H6O3 |
Purity | ≥95% |
Storage | Store at -20 ℃ |
IUPAC Name | benzo[f][2]benzofuran-1,3-dione |
InChI | InChI=1S/C12H6O3/c13-11-9-5-7-3-1-2-4-8(7)6-10(9)12(14)15-11/h1-6H |
InChIKey | IZJDCINIYIMFGX-UHFFFAOYSA-N |
SMILES | C1=CC=C2C=C3C(=CC2=C1)C(=O)OC3=O |
Reference | [1]. Wenzel TJ, Rollo RD, Clark RL. Chiral discrimination of aliphatic amines and amino alcohols using NMR spectroscopy. Magn Reson Chem. 2012 Apr;50(4):261-5. doi: 10.1002/mrc.2855. Epub 2012 Mar 14. PMID: 22415973.<br /> |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |