For research use only. Not for therapeutic Use.
2,3-Pentanedione, 4,5-dihydroxy- (9CI)(Cat No.:M091483) is a specialized chemical compound that fits into the category of diketones, characterized by having two keto groups (carbonyl groups) within its molecular structure. The particular nomenclature, “4,5-dihydroxy,” indicates that there are hydroxyl groups attached to the fourth and fifth carbon atoms of the molecule. This compound is used in various chemical applications, primarily in research and development settings. Its unique structure makes it useful in organic synthesis and potentially in pharmaceutical developments, where modifications of diketones often lead to new drug candidates.
Catalog Number | M091483 |
CAS Number | 142937-55-1 |
Molecular Formula | C5H8O4 |
Purity | ≥95% |
Documentation | |
Target | Endogenous Metabolite |
Storage | Store at -20C |
IUPAC Name | 4,5-dihydroxypentane-2,3-dione |
InChI | InChI=1S/C5H8O4/c1-3(7)5(9)4(8)2-6/h4,6,8H,2H2,1H3 |
InChIKey | UYTRITJAZOPLCZ-UHFFFAOYSA-N |
SMILES | CC(=O)C(=O)C(CO)O |