For research use only. Not for therapeutic Use.
2,3,4-Trichloroaniline(CAT: R025210) is a high-purity compound widely used in chemical and pharmaceutical research. This chloro-substituted aniline serves as a key intermediate in the synthesis of dyes, agrochemicals, and pharmaceutical agents. Its unique trichloro structure enhances its reactivity, making it suitable for various chemical transformations, including nucleophilic substitution and amination reactions. Additionally, 2,3,4-Trichloroaniline is employed in environmental studies to evaluate degradation pathways and pollutant behavior. Its stable molecular framework ensures consistent performance in experimental setups. Ideal for advanced research and industrial applications, 2,3,4-Trichloroaniline offers versatility and reliability in exploring innovative chemical processes and product development.
CAS Number | 634-67-3 |
Synonyms | 2,3,4-Trichlorobenzenamine; 1-Amino-2,3,4-trichlorobenzene; NSC 89297 |
Molecular Formula | C6H4Cl3N |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2,3,4-trichloroaniline |
InChI | InChI=1S/C6H4Cl3N/c7-3-1-2-4(10)6(9)5(3)8/h1-2H,10H2 |
InChIKey | RRJUYQOFOMFVQS-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1N)Cl)Cl)Cl |