For research use only. Not for therapeutic Use.
2,3,4-Trifluorobenzylamine(CAT: L011412) is a high-purity fluorinated aromatic amine widely used in pharmaceutical research and organic synthesis. Featuring a benzylamine core with three strategically positioned fluorine atoms, it serves as a key intermediate in the development of bioactive molecules, small-molecule inhibitors, and agrochemicals. Its unique structure allows for enhanced metabolic stability and improved pharmacokinetic properties, making it valuable in medicinal chemistry and fluorine-containing compound synthesis. Known for its chemical stability and reactivity, 2,3,4-Trifluorobenzylamine supports innovative pathways in drug discovery and material science, ensuring precision and efficiency in both academic and industrial research applications.
CAS Number | 235088-67-2 |
Molecular Formula | C7H6F3N |
Purity | ≥95% |
IUPAC Name | (2,3,4-trifluorophenyl)methanamine |
InChI | InChI=1S/C7H6F3N/c8-5-2-1-4(3-11)6(9)7(5)10/h1-2H,3,11H2 |
InChIKey | YIWUAPISITUDBY-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1CN)F)F)F |