For research use only. Not for therapeutic Use.
2,3,4-Trimethylpentane (Cat No.:R069148) is a branched-chain alkane hydrocarbon with the molecular formula C8H18. Commonly known as iso-octane, it is used as a reference standard in the octane rating scale for measuring the performance of gasoline. Iso-octane has a high resistance to knocking or detonation in internal combustion engines, making it a valuable component in gasoline blends to improve engine efficiency and reduce emissions. Its structure includes three methyl groups attached to the third, fourth, and fifth carbon atoms of a pentane chain, leading to its unique properties as a high-octane fuel additive.
CAS Number | 565-75-3 |
Molecular Formula | C8H18 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 2,3,4-trimethylpentane |
InChI | InChI=1S/C8H18/c1-6(2)8(5)7(3)4/h6-8H,1-5H3 |
InChIKey | RLPGDEORIPLBNF-UHFFFAOYSA-N |
SMILES | CC(C)C(C)C(C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |