For research use only. Not for therapeutic Use.
2,3,4,5-Tetrachloropyridine(Cat No.:L017846)is a chlorinated heterocyclic compound widely used in pharmaceutical and agrochemical research. Its high degree of chlorination provides unique reactivity, making it a valuable intermediate in the synthesis of complex organic molecules. The tetrachloropyridine structure serves as a versatile building block for creating new compounds, particularly in the development of pesticides, herbicides, and potential drug candidates. Its stability and reactivity also make it useful in cross-coupling reactions and other chemical processes, contributing to the design of bioactive molecules and materials.
CAS Number | 2808-86-8 |
Molecular Formula | C5HCl4N |
Purity | ≥95% |
IUPAC Name | 2,3,4,5-tetrachloropyridine |
InChI | InChI=1S/C5HCl4N/c6-2-1-10-5(9)4(8)3(2)7/h1H |
InChIKey | DLOOKZXVYJHDIY-UHFFFAOYSA-N |
SMILES | C1=C(C(=C(C(=N1)Cl)Cl)Cl)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |