For research use only. Not for therapeutic Use.
2,3,4,5-Tetrahydro-7-methoxy-1,4-benzothiazepine (Cat No.:M102790) is a chemical compound that belongs to the class of benzothiazepine derivatives. It is a tetrahydrofuran-fused benzothiazepine ring system with a methoxy substituent at position 7. This compound’s structure is similar to calcium channel blockers like diltiazem, which are used to treat cardiovascular conditions such as hypertension and angina. However, the specific pharmacological and therapeutic properties of 2,3,4,5-tetrahydro-7-methoxy-1,4-benzothiazepine would require further research and evaluation to determine its potential medical applications and effects on biological systems.
CAS Number | 145903-31-7 |
Molecular Formula | C10H13NOS |
Purity | ≥95% |
Storage | Room temperature |
IUPAC Name | 7-methoxy-2,3,4,5-tetrahydro-1,4-benzothiazepine |
InChI | InChI=1S/C10H13NOS/c1-12-9-2-3-10-8(6-9)7-11-4-5-13-10/h2-3,6,11H,4-5,7H2,1H3 |
InChIKey | VXSSDKLUAZVADY-UHFFFAOYSA-N |
SMILES | COC1=CC2=C(C=C1)SCCNC2 |