For research use only. Not for therapeutic Use.
2,3,4,5,6-Pentachlorostyrene is an organochlorine compound used in chemical research and industrial applications. Its structure consists of a styrene backbone with five chlorine atoms substituted on the benzene ring, providing significant stability and unique reactivity. This compound is commonly employed in the synthesis of polymers, specialty chemicals, and in studying the environmental effects of chlorinated aromatic compounds. Its high chlorination makes it resistant to degradation, contributing to its use in materials science and environmental chemistry research.
CAS Number | 14992-81-5 |
Synonyms | 1-Ethenyl-2,3,4,5,6-pentachlorobenzene |
Molecular Formula | C8H3Cl5 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 1,2,3,4,5-pentachloro-6-ethenylbenzene |
InChI | InChI=1S/C8H3Cl5/c1-2-3-4(9)6(11)8(13)7(12)5(3)10/h2H,1H2 |
InChIKey | AGOFZVAQMFVJEQ-UHFFFAOYSA-N |
SMILES | C=CC1=C(C(=C(C(=C1Cl)Cl)Cl)Cl)Cl |