For research use only. Not for therapeutic Use.
2,3,5-Trifluorobenzenesulphonamide(Cat No.:L007725), is a chemical compound with significant applications in medicinal and synthetic chemistry. Its structure features a sulphonamide group attached to a trifluorobenzene ring. Sulphonamides have been historically important in medicinal chemistry, often used as antibiotics and antimicrobial agents. This compound is likely used as a precursor or intermediate in the synthesis of more complex organic molecules. Its specific structure makes it valuable for creating diverse compounds in pharmaceutical research, contributing to advancements in drug discovery and the development of therapeutic agents for various diseases and conditions.
CAS Number | 914637-01-7 |
Molecular Formula | C6H4F3NO2S |
Purity | ≥95% |
IUPAC Name | 2,3,5-trifluorobenzenesulfonamide |
InChI | InChI=1S/C6H4F3NO2S/c7-3-1-4(8)6(9)5(2-3)13(10,11)12/h1-2H,(H2,10,11,12) |
InChIKey | AQXRXUMQOXDPKW-UHFFFAOYSA-N |
SMILES | C1=C(C=C(C(=C1F)F)S(=O)(=O)N)F |