For research use only. Not for therapeutic Use.
2,3,5,6-Tetramethyl-1,4-phenylenediamine is a versatile organic compound commonly used in chemical research and analytical applications. Known for its role as a redox-active species, it acts as a reducing agent in various reactions, particularly in the detection and quantification of oxidants. Its stability and solubility make it suitable for applications in electrochemical analysis, corrosion studies, and as a reagent in the synthesis of other organic compounds. This compound is valued for its reactivity and precision in chemical processes.
Catalog Number | L046798 |
CAS Number | 3102-87-2 |
Molecular Formula | C10H16N2 |
Purity | ≥95% |
IUPAC Name | 2,3,5,6-tetramethylbenzene-1,4-diamine |
InChI | InChI=1S/C10H16N2/c1-5-6(2)10(12)8(4)7(3)9(5)11/h11-12H2,1-4H3 |
InChIKey | WCZNKVPCIFMXEQ-UHFFFAOYSA-N |
SMILES | CC1=C(C(=C(C(=C1N)C)C)N)C |