For research use only. Not for therapeutic Use.
2,3,5,6-Tetramethylterephthalaldehyde(Cat No.:L006856), is an organic compound employed in organic synthesis and materials science. Its molecular structure includes a terephthalaldehyde core with four methyl groups attached at different positions. This compound serves as a versatile building block for the preparation of various complex organic molecules and polymers. Chemists utilize its specific structure to create functional materials and conduct research in the development of advanced materials for applications such as sensors, organic electronics, and coatings.
CAS Number | 7072-01-7 |
Molecular Formula | C12H14O2 |
Purity | ≥95% |
IUPAC Name | 2,3,5,6-tetramethylterephthalaldehyde |
InChI | InChI=1S/C12H14O2/c1-7-8(2)12(6-14)10(4)9(3)11(7)5-13/h5-6H,1-4H3 |
InChIKey | PWVFZPCOVWTNCN-UHFFFAOYSA-N |
SMILES | CC1=C(C(=C(C(=C1C=O)C)C)C=O)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |