(2,3,6-Trifluorophenyl)hydrazine hydrochloride (Cat.No:L004089) is a significant chemical compound with diverse applications. Its unique structure, featuring a trifluorophenyl hydrazine group, imparts specialized reactivity and properties. This compound serves as a crucial intermediate in the synthesis of specialized materials and pharmaceuticals.
Catalog Number | L004089 |
CAS Number | 2137836-61-2 |
Molecular Formula | C6H6ClF3N2 |
Purity | ≥95% |
IUPAC Name | (2,3,6-trifluorophenyl)hydrazine;hydrochloride |
InChI | InChI=1S/C6H5F3N2.ClH/c7-3-1-2-4(8)6(11-10)5(3)9;/h1-2,11H,10H2;1H |
InChIKey | YTXCKYWGUVFJGN-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1F)NN)F)F.Cl |