For research use only. Not for therapeutic Use.
2,3,6,7,10,11-Hexahydroxytriphenylene (CAT: R074456) is a chemical compound with a hexahydroxyphenyl structure. This compound may have applications in various chemical and research fields, including organic chemistry, materials science, and pharmaceuticals. Its specific properties and uses would depend on its reactivity and behavior in different chemical reactions and processes.
CAS Number | 4877-80-9 |
Molecular Formula | C18H12O6 |
Purity | ≥95% |
IUPAC Name | triphenylene-2,3,6,7,10,11-hexol |
InChI | InChI=1S/C18H12O6/c19-13-1-7-8(2-14(13)20)10-4-17(23)18(24)6-12(10)11-5-16(22)15(21)3-9(7)11/h1-6,19-24H |
InChIKey | QMLILIIMKSKLES-UHFFFAOYSA-N |
SMILES | C1=C2C3=CC(=C(C=C3C4=CC(=C(C=C4C2=CC(=C1O)O)O)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |