For research use only. Not for therapeutic Use.
24(28)-Dehydroergosterol is a high-purity sterol essential for advanced pharmaceutical and biochemical research. This compound is crucial for studies on sterol metabolism, membrane biology, and fungal biochemistry. Known for its stability and precise structure, it integrates seamlessly into experimental protocols, providing reliable and consistent results for high-precision investigations in various scientific applications.
| CAS Number | 29560-24-5 |
| Synonyms | (E)-Ergosta-5,7,22,24(28)-tetraen-3β-ol; Ergosta-5,7,22,24(28)-tetraene-3β-ol; Ergosta-5,7,trans-22,24(28)-tetraen-3β-ol? |
| Molecular Formula | C28H42O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | (3S,9S,10R,13R,14R,17R)-10,13-dimethyl-17-[(E,2R)-6-methyl-5-methylidenehept-3-en-2-yl]-2,3,4,9,11,12,14,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-ol |
| InChI | InChI=1S/C28H42O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h7-10,18,20,22,24-26,29H,3,11-17H2,1-2,4-6H3/b8-7+/t20-,22+,24-,25+,26+,27+,28-/m1/s1 |
| InChIKey | SQFQJKZSFOZDJY-CVGLIYDESA-N |
| SMILES | CC(C)C(=C)C=CC(C)C1CCC2C1(CCC3C2=CC=C4C3(CCC(C4)O)C)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
