For research use only. Not for therapeutic Use.
2,4-Bisphenol S is a high-purity compound essential for advanced pharmaceutical and chemical research. This bisphenol derivative is crucial for studies involving polymer synthesis, endocrine disruption, and material science. Known for its stability and reactivity, it integrates seamlessly into experimental protocols, providing reliable and consistent results for high-precision investigations in various scientific applications.
CAS Number | 5397-34-2 |
Synonyms | 2,4’-Bisphenol sulfone; 2,4’-Dihydroxydiphenyl sulfone; 2,4’-Sulfonyldiphenol; 2-(4-Hydroxyphenylsulfonyl)phenol; 24BS; 4,2’-Dihydroxydiphenyl sulfone; BPS 24; BPS 24C; NSC 2432 |
Molecular Formula | C12H10O4S |
Purity | ≥95% |
Storage | Refrigerator |
IUPAC Name | 2-(4-hydroxyphenyl)sulfonylphenol |
InChI | InChI=1S/C12H10O4S/c13-9-5-7-10(8-6-9)17(15,16)12-4-2-1-3-11(12)14/h1-8,13-14H |
InChIKey | LROZSPADHSXFJA-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)O)S(=O)(=O)C2=CC=C(C=C2)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |