For research use only. Not for therapeutic Use.
2,4-D-13C6(Cat No.:S000851) is a stable isotope-labeled version of the herbicide 2,4-dichlorophenoxyacetic acid, where all six carbon atoms are enriched with the 13C isotope, resulting in the molecular formula C213C6H6Cl2O3. This labeled compound is primarily used in environmental and agricultural chemistry research to study the behavior and degradation of 2,4-D in ecosystems using mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy. 2,4-D-13C6 helps in understanding the environmental fate of herbicides, their persistence, and their impact on non-target species, facilitating the development of safer and more effective herbicidal applications.
CAS Number | 150907-52-1 |
Molecular Formula | C213C6H6Cl2O3 |
Purity | ≥95% |
IUPAC Name | 2-(2,4-dichloro(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-trien-1-yl)oxyacetic acid |
InChI | InChI=1S/C8H6Cl2O3/c9-5-1-2-7(6(10)3-5)13-4-8(11)12/h1-3H,4H2,(H,11,12)/i1+1,2+1,3+1,5+1,6+1,7+1 |
InChIKey | OVSKIKFHRZPJSS-JTZKEMBVSA-N |
SMILES | C1=CC(=C(C=C1Cl)Cl)OCC(=O)O |