For research use only. Not for therapeutic Use.
2,4-D dimethylamine salt(Cat No.:R069154)is a widely used herbicidal formulation of the phenoxyacetic acid herbicide 2,4-Dichlorophenoxyacetic acid, paired with dimethylamine for increased solubility and efficacy. This salt form is effective against broadleaf weeds, sparing grasses, which makes it particularly valuable in lawns, cereals, and pastures. It acts as a synthetic auxin, mimicking natural plant hormones to disrupt normal growth patterns, leading to the death of target plants. Its application is crucial in managing invasive species and optimizing crop yields by reducing weed competition, thereby supporting sustainable agricultural practices.
CAS Number | 2008-39-1 |
Synonyms | DMA 4 |
Molecular Formula | C10H13Cl2NO3 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 2-(2,4-dichlorophenoxy)acetic acid;N-methylmethanamine |
InChI | InChI=1S/C8H6Cl2O3.C2H7N/c9-5-1-2-7(6(10)3-5)13-4-8(11)12;1-3-2/h1-3H,4H2,(H,11,12);3H,1-2H3 |
InChIKey | IUQJDHJVPLLKFL-UHFFFAOYSA-N |
SMILES | CNC.C1=CC(=C(C=C1Cl)Cl)OCC(=O)O |