For research use only. Not for therapeutic Use.
2,4-Di([1,1′-biphenyl]-3-yl)-6-chloro-1,3,5-triazine(Cat No.:L017997)is a complex aromatic compound used in advanced organic synthesis and materials science. The triazine core, substituted with biphenyl groups at the 2 and 4 positions and a chlorine atom at the 6 position, offers significant stability and reactivity. This compound is particularly valuable in the development of advanced polymers, electronic materials, and as a key intermediate in pharmaceutical synthesis. Its unique structure enables the creation of complex molecular architectures, making it essential for researchers in materials chemistry and drug development.
CAS Number | 1205748-61-3 |
Molecular Formula | C27H18ClN3 |
Purity | ≥95% |
IUPAC Name | 2-chloro-4,6-bis(3-phenylphenyl)-1,3,5-triazine |
InChI | InChI=1S/C27H18ClN3/c28-27-30-25(23-15-7-13-21(17-23)19-9-3-1-4-10-19)29-26(31-27)24-16-8-14-22(18-24)20-11-5-2-6-12-20/h1-18H |
InChIKey | SVNMSEVGOAHNKQ-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)C3=NC(=NC(=N3)Cl)C4=CC=CC(=C4)C5=CC=CC=C5 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |