For research use only. Not for therapeutic Use.
2,4-Diacetyl-1,3-benzenediol (Cat.No:L004110) is a significant chemical compound widely employed in pharmaceutical and cosmetic industries. Commonly known as hydroquinone diacetate, it is a precursor in the synthesis of various pharmaceuticals and acts as a skin-lightening agent in cosmetic products. Its unique chemical properties make it a crucial ingredient in the formulation of specialized skin-care products, highlighting its importance in both pharmaceutical and cosmetic applications.
CAS Number | 2163-12-4 |
Molecular Formula | C10H10O4 |
Purity | ≥95% |
IUPAC Name | 1-(3-acetyl-2,4-dihydroxyphenyl)ethanone |
InChI | InChI=1S/C10H10O4/c1-5(11)7-3-4-8(13)9(6(2)12)10(7)14/h3-4,13-14H,1-2H3 |
InChIKey | AONRSNZGOMBWPX-UHFFFAOYSA-N |
SMILES | CC(=O)C1=C(C(=C(C=C1)O)C(=O)C)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |