For research use only. Not for therapeutic Use.
2,4-Diamino-6-phenyl-7-pteridinol(CAT: R008829) plays a crucial role in the pharmaceutical industry. This compound is a key intermediate in the synthesis of antifolate drugs, which are essential for inhibiting the dihydrofolate reductase enzyme in various microorganisms and cancer cells. This inhibition disrupts DNA synthesis and cell proliferation, making it a valuable compound in cancer chemotherapy and antibacterial medications. In organic chemistry, it serves as a fundamental building block for creating novel pteridine derivatives with potential pharmacological activities.
CAS Number | 19152-93-3 |
Synonyms | 2,4-Diamino-6-phenyl-7(1H)-pteridinone; 2,4-Diamino-7-hydroxy-6-phenylpteridine; NSC 33416; Triamterine Impurity C; Triamterene Inpurity C; USP Triamterene Related Compound C; |
Molecular Formula | C12H10N6O |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2,4-diamino-6-phenyl-8H-pteridin-7-one |
InChI | InChI=1S/C12H10N6O/c13-9-8-10(18-12(14)16-9)17-11(19)7(15-8)6-4-2-1-3-5-6/h1-5H,(H5,13,14,16,17,18,19) |
InChIKey | USTXKGPQJJRCTO-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)C2=NC3=C(NC2=O)N=C(N=C3N)N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |