For research use only. Not for therapeutic Use.
2,4-Diamino-6,7-diisopropylpteridine Phosphate(Cat No.:R056235)is a synthetic pteridine derivative known for its role as a dihydrofolate reductase (DHFR) inhibitor. By targeting DHFR, it disrupts the folate cycle, which is essential for DNA synthesis and cell replication, particularly in rapidly dividing cells like parasites and certain bacteria. This compound is commonly used in research and drug development for antimicrobial and antiprotozoal therapies. Its potent inhibitory action has made it a valuable tool in studying resistance mechanisms and designing drugs for conditions like malaria and bacterial infections.
CAS Number | 84176-65-8 |
Synonyms | 6,7-Bis(1-methylethyl)-2,4-pteridinediamine Phosphate; NSC 98771; |
Molecular Formula | C12H21N6O4P |
Purity | ≥95% |
Target | Parasite |
Storage | 2-8°C |
IUPAC Name | 6,7-di(propan-2-yl)pteridine-2,4-diamine;phosphoric acid |
InChI | InChI=1S/C12H18N6.H3O4P/c1-5(2)7-8(6(3)4)16-11-9(15-7)10(13)17-12(14)18-11;1-5(2,3)4/h5-6H,1-4H3,(H4,13,14,16,17,18);(H3,1,2,3,4) |
InChIKey | YNQBQYASRYRNRY-UHFFFAOYSA-N |
SMILES | CC(C)C1=NC2=C(N=C(N=C2N=C1C(C)C)N)N.OP(=O)(O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |