For research use only. Not for therapeutic Use.
2,4-Diaminopyrimidine-5-carboxamide is a pyrimidine derivative characterized by amino groups at the 2 and 4 positions and a carboxamide group at the 5 position. This compound is notable for its potential biological activity, making it relevant in pharmaceutical research, particularly in the development of antimicrobial and antiviral agents. Its structure allows for various modifications, which can enhance its efficacy and selectivity. Additionally, the presence of multiple functional groups offers opportunities for diverse applications in synthetic and medicinal chemistry.
CAS Number | 66131-74-6 |
Molecular Formula | C5H7N5O |
Purity | ≥95% |
IUPAC Name | 2,4-diaminopyrimidine-5-carboxamide |
InChI | InChI=1S/C5H7N5O/c6-3-2(4(7)11)1-9-5(8)10-3/h1H,(H2,7,11)(H4,6,8,9,10) |
InChIKey | VULZVYGZVOMUKU-UHFFFAOYSA-N |
SMILES | C1=C(C(=NC(=N1)N)N)C(=O)N |