For research use only. Not for therapeutic Use.
2,4-Dibromo-1,3,5-trimethylbenzene(Cat No.:L017703)is a key intermediate in organic synthesis, particularly valuable in the development of advanced materials, pharmaceuticals, and specialty chemicals. The presence of two bromine atoms on the trimethylbenzene core enhances its reactivity, making it suitable for a variety of chemical transformations, including cross-coupling reactions. This compound is often used in the synthesis of liquid crystals, polymers, and other materials requiring precise structural modifications. Researchers rely on its high purity and stability to explore new synthetic pathways and develop innovative products with specific functional properties.
CAS Number | 6942-99-0 |
Molecular Formula | C9H10Br2 |
Purity | ≥95% |
IUPAC Name | 2,4-dibromo-1,3,5-trimethylbenzene |
InChI | InChI=1S/C9H10Br2/c1-5-4-6(2)9(11)7(3)8(5)10/h4H,1-3H3 |
InChIKey | CIHJFEWFZJQTFE-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(C(=C1Br)C)Br)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |