For research use only. Not for therapeutic Use.
2,4-Dibromo-3-chloropyridine(Cat No.:M349478)is a halogenated pyridine derivative used in pharmaceutical and chemical research. This compound features bromine atoms at the 2- and 4-positions and a chlorine atom at the 3-position of the pyridine ring, making it a highly reactive intermediate for synthesizing complex molecules. It is particularly valuable in the development of bioactive compounds, such as potential therapeutic agents and agrochemicals. The unique combination of bromine and chlorine atoms allows for diverse reactivity, supporting advanced research in medicinal chemistry, material science, and organic synthesis.
CAS Number | 861024-77-3 |
Molecular Formula | C5H2Br2ClN |
Purity | ≥95% |
IUPAC Name | 2,4-dibromo-3-chloropyridine |
InChI | InChI=1S/C5H2Br2ClN/c6-3-1-2-9-5(7)4(3)8/h1-2H |
InChIKey | WCARRWYHMKUGRY-UHFFFAOYSA-N |
SMILES | C1=CN=C(C(=C1Br)Cl)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |