For research use only. Not for therapeutic Use.
2,4-Dibromo-6-isopropylaniline(CAT: L026434) is a high-purity aromatic compound featuring two bromine atoms and an isopropyl group on an aniline scaffold. This versatile molecule is widely used in pharmaceutical, agrochemical, and material science research as a building block for synthesizing complex bioactive molecules and functional materials. The bromine atoms enable cross-coupling reactions such as Suzuki-Miyaura and Sonogashira, while the aniline functionality allows for further derivatization through amide or imine formation. With its unique substitution pattern and excellent reactivity, 2,4-Dibromo-6-isopropylaniline is an essential reagent for innovative research in medicinal chemistry and organic synthesis.
CAS Number | 81090-45-1 |
Molecular Formula | C9H11Br2N |
Purity | ≥95% |
IUPAC Name | 2,4-dibromo-6-propan-2-ylaniline |
InChI | InChI=1S/C9H11Br2N/c1-5(2)7-3-6(10)4-8(11)9(7)12/h3-5H,12H2,1-2H3 |
InChIKey | OKIHDLUSXGDARZ-UHFFFAOYSA-N |
SMILES | CC(C)C1=C(C(=CC(=C1)Br)Br)N |