For research use only. Not for therapeutic Use.
2,4-Dibromonicotinic acid(CAT: L022572) is a brominated derivative of nicotinic acid, a pyridine-based compound with bromine atoms at the 2 and 4 positions. This compound is frequently used as a precursor or building block in the synthesis of various organic molecules, especially in pharmaceutical and agricultural research. The bromine atoms on the pyridine ring make it highly reactive and suitable for further functionalization via cross-coupling or substitution reactions. Additionally, the carboxylic acid group at the 3-position allows for modifications, such as amide or ester formation, making 2,4-Dibromonicotinic acid a versatile intermediate in synthesizing heterocyclic compounds. It is commonly employed in designing bioactive molecules, particularly in studies aiming to explore the biological properties of pyridine derivatives.
Catalog Number | L022572 |
CAS Number | 1269291-41-9 |
Molecular Formula | C6H3Br2NO2 |
Purity | ≥95% |
IUPAC Name | 2,4-dibromopyridine-3-carboxylic acid |
InChI | InChI=1S/C6H3Br2NO2/c7-3-1-2-9-5(8)4(3)6(10)11/h1-2H,(H,10,11) |
InChIKey | MJSYWAFSWWCKTB-UHFFFAOYSA-N |